Online Database of Chemicals from Around the World
|
CAS#: 74417-06-4 Product: 5-Phenyl-3-(Phenylmethoxy)-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-Phenyl-3-(Phenylmethoxy)-1,2,4-Triazine |
|---|---|
| Synonyms | 3-(Benzyloxy)-5-Phenyl-1,2,4-Triazine; 1,2,4-Triazine, 5-Phenyl-3-(Phenylmethoxy)-; 3-(Benzyloxy)-5-Phenyl-As-Triazine |
| Molecular Structure |  |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 |
| CAS Registry Number | 74417-06-4 |
| SMILES | C1=C(N=C(N=N1)OCC2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H13N3O/c1-3-7-13(8-4-1)12-20-16-18-15(11-17-19-16)14-9-5-2-6-10-14/h1-11H,12H2 |
| InChIKey | UPBLLHHGQZQDOB-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.491°C at 760 mmHg (Cal.) |
| Flash point | 169.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Phenyl-3-(Phenylmethoxy)-1,2,4-Triazine |