|
CAS#: 77528-83-7 Product: N-[(2-Ethyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methyl]Ethanamine Hydrochloride No suppilers available for the product. |
| Name | N-[(2-Ethyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methyl]Ethanamine Hydrochloride |
|---|---|
| Synonyms | Ethyl-[(2-Ethyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methyl]Amine Hydrochloride; 4,5,6,7-Tetrahydro-N,2-Diethyl-6-Benzothiazolemethanamine Hydrochloride; 6-Benzothiazolemethanamine, 4,5,6,7-Tetrahydro-N,2-Diethyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.82 |
| CAS Registry Number | 77528-83-7 |
| SMILES | [H+].C(C1=NC2=C(S1)CC(CC2)CNCC)C.[Cl-] |
| InChI | 1S/C12H20N2S.ClH/c1-3-12-14-10-6-5-9(8-13-4-2)7-11(10)15-12;/h9,13H,3-8H2,1-2H3;1H |
| InChIKey | HECBDWCPBAUOGG-UHFFFAOYSA-N |
| Boiling point | 332.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Ethyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-6-Yl)Methyl]Ethanamine Hydrochloride |