|
CAS#: 78144-04-4 Product: Butyl (E)-2,3,4,4-Tetrachlorobut-2-Enoate No suppilers available for the product. |
| Name | Butyl (E)-2,3,4,4-Tetrachlorobut-2-Enoate |
|---|---|
| Synonyms | (E)-2,3,4,4-Tetrachlorobut-2-Enoic Acid Butyl Ester; Butyl 2,3,4,4-Tetrachloro-2-Butenoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl4O2 |
| Molecular Weight | 279.98 |
| CAS Registry Number | 78144-04-4 |
| EINECS | 278-850-9 |
| SMILES | C(OC(=O)\C(Cl)=C(Cl)\C(Cl)Cl)CCC |
| InChI | 1S/C8H10Cl4O2/c1-2-3-4-14-8(13)6(10)5(9)7(11)12/h7H,2-4H2,1H3/b6-5+ |
| InChIKey | XKEIIIHSHOBHEJ-AATRIKPKSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.659°C at 760 mmHg (Cal.) |
| Flash point | 118.281°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl (E)-2,3,4,4-Tetrachlorobut-2-Enoate |