|
CAS#: 81250-24-0 Product: 1-Propyl-3-Butyl-8-Methylxanthine No suppilers available for the product. |
| Name | 1-Propyl-3-Butyl-8-Methylxanthine |
|---|---|
| Synonyms | 3-Butyl-8-Methyl-1-Propyl-7H-Purine-2,6-Quinone; 3,7-Dihydro-3-Butyl-8-Methyl-1-Propyl-1H-Purine-2,6-Dione; 1-Propyl-3-Butyl-8-Methylxanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 |
| CAS Registry Number | 81250-24-0 |
| SMILES | C(N2C(N(C1=C([NH]C(=N1)C)C2=O)CCCC)=O)CC |
| InChI | 1S/C13H20N4O2/c1-4-6-8-16-11-10(14-9(3)15-11)12(18)17(7-5-2)13(16)19/h4-8H2,1-3H3,(H,14,15) |
| InChIKey | QMRNVBQRDCPVDY-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.416°C at 760 mmHg (Cal.) |
| Flash point | 246.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Propyl-3-Butyl-8-Methylxanthine |