|
CAS#: 84604-41-1 Product: 4-(3-Oxobutyl)Phenyl Propionate No suppilers available for the product. |
| Name | 4-(3-Oxobutyl)Phenyl Propionate |
|---|---|
| Synonyms | Propanoic Acid [4-(3-Oxobutyl)Phenyl] Ester; Propionic Acid [4-(3-Ketobutyl)Phenyl] Ester; Nsc39439 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 84604-41-1 |
| EINECS | 283-321-0 |
| SMILES | C1=C(OC(=O)CC)C=CC(=C1)CCC(=O)C |
| InChI | 1S/C13H16O3/c1-3-13(15)16-12-8-6-11(7-9-12)5-4-10(2)14/h6-9H,3-5H2,1-2H3 |
| InChIKey | NBNZUDHERZHGTE-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.752°C at 760 mmHg (Cal.) |
| Flash point | 140.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Oxobutyl)Phenyl Propionate |