|
CAS#: 85650-69-7 Product: Ethyl 17-Hydroxy-11alpha-(Mesyloxy)-16beta-Methylpregna-1,4-Diene-3,20-Dione 21-Carbonate No suppilers available for the product. |
| Name | Ethyl 17-Hydroxy-11alpha-(Mesyloxy)-16beta-Methylpregna-1,4-Diene-3,20-Dione 21-Carbonate |
|---|---|
| Synonyms | ethyl 17- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H37O9S |
| Molecular Weight | 525.63 |
| CAS Registry Number | 85650-69-7 |
| EINECS | 288-078-4 |
| SMILES | [O-]C(=O)OCC.CC(=O)[C@@]2(O)[C@@H](C)C[C@H]1[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](C[C@@]12C)OS(C)(=O)=O |
| InChI | 1S/C23H32O6S.C3H6O3/c1-13-10-18-17-7-6-15-11-16(25)8-9-21(15,3)20(17)19(29-30(5,27)28)12-22(18,4)23(13,26)14(2)24;1-2-6-3(4)5/h8-9,11,13,17-20,26H,6-7,10,12H2,1-5H3;2H2,1H3,(H,4,5)/p-1/t13-,17-,18-,19+,20+,21-,22-,23-;/m0./s1 |
| InChIKey | ASUNALPWIPEKHX-NKZFVOFPSA-M |
| Boiling point | 706.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 380.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 17-Hydroxy-11alpha-(Mesyloxy)-16beta-Methylpregna-1,4-Diene-3,20-Dione 21-Carbonate |