|
CAS#: 864685-28-9 Product: N-(2,2-Dimethoxyethyl)-6-[5-(phenylsulfanyl)-2-thienyl]nicotinamide No suppilers available for the product. |
| Name | N-(2,2-Dimethoxyethyl)-6-[5-(phenylsulfanyl)-2-thienyl]nicotinamide |
|---|---|
| Synonyms | 3-PYRIDIN |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.51 |
| CAS Registry Number | 864685-28-9 |
| SMILES | COC(OC)CNC(=O)c1ccc(nc1)c3ccc(Sc2ccccc2)s3 |
| InChI | 1S/C20H20N2O3S2/c1-24-18(25-2)13-22-20(23)14-8-9-16(21-12-14)17-10-11-19(27-17)26-15-6-4-3-5-7-15/h3-12,18H,13H2,1-2H3,(H,22,23) |
| InChIKey | NVCMXIXPZUZJMN-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.565°C at 760 mmHg (Cal.) |
| Flash point | 319.43°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,2-Dimethoxyethyl)-6-[5-(phenylsulfanyl)-2-thienyl]nicotinamide |