|
CAS#: 864685-29-0 Product: 6-(5-Benzyl-2-thienyl)-N-(2,2-dimethoxyethyl)nicotinamide No suppilers available for the product. |
| Name | 6-(5-Benzyl-2-thienyl)-N-(2,2-dimethoxyethyl)nicotinamide |
|---|---|
| Synonyms | 3-PYRIDIN |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.48 |
| CAS Registry Number | 864685-29-0 |
| SMILES | COC(OC)CNC(=O)c1ccc(nc1)c3ccc(Cc2ccccc2)s3 |
| InChI | 1S/C21H22N2O3S/c1-25-20(26-2)14-23-21(24)16-8-10-18(22-13-16)19-11-9-17(27-19)12-15-6-4-3-5-7-15/h3-11,13,20H,12,14H2,1-2H3,(H,23,24) |
| InChIKey | UXDSNPRIPDZSAP-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.703°C at 760 mmHg (Cal.) |
| Flash point | 289.274°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(5-Benzyl-2-thienyl)-N-(2,2-dimethoxyethyl)nicotinamide |