|
CAS#: 864685-31-4 Product: Methyl 5-cyano-6-[(2,2-difluoroethyl)sulfanyl]-2-(dimethoxymethyl)nicotinate No suppilers available for the product. |
| Name | Methyl 5-cyano-6-[(2,2-difluoroethyl)sulfanyl]-2-(dimethoxymethyl)nicotinate |
|---|---|
| Synonyms | 3-PYRIDIN |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F2N2O4S |
| Molecular Weight | 332.32 |
| CAS Registry Number | 864685-31-4 |
| SMILES | COC(OC)c1nc(SCC(F)F)c(cc1C(=O)OC)C#N |
| InChI | 1S/C13H14F2N2O4S/c1-19-12(18)8-4-7(5-16)11(22-6-9(14)15)17-10(8)13(20-2)21-3/h4,9,13H,6H2,1-3H3 |
| InChIKey | LYQRXFHWQXQXJZ-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.156°C at 760 mmHg (Cal.) |
| Flash point | 204.274°C (Cal.) |
| Refractive index | 1.518 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-cyano-6-[(2,2-difluoroethyl)sulfanyl]-2-(dimethoxymethyl)nicotinate |