|
CAS#: 86870-50-0 Product: 1-[2,6-Dinitro-4-(trifluoromethyl)phenyl]-2-(1,1,1,3,3,3-hexafluoro-2-propanylidene)hydrazine No suppilers available for the product. |
| Name | 1-[2,6-Dinitro-4-(trifluoromethyl)phenyl]-2-(1,1,1,3,3,3-hexafluoro-2-propanylidene)hydrazine |
|---|---|
| Synonyms | 2-Propano |
| Molecular Structure | ![]() |
| Molecular Formula | C10H3F9N4O4 |
| Molecular Weight | 414.14 |
| CAS Registry Number | 86870-50-0 |
| SMILES | FC(F)(F)\C(=N/Nc1c(cc(cc1[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O)C(F)(F)F |
| InChI | 1S/C10H3F9N4O4/c11-8(12,13)3-1-4(22(24)25)6(5(2-3)23(26)27)20-21-7(9(14,15)16)10(17,18)19/h1-2,20H |
| InChIKey | KFKVMKWTLGWUDA-UHFFFAOYSA-N |
| Density | 1.821g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.449°C at 760 mmHg (Cal.) |
| Flash point | 114.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2,6-Dinitro-4-(trifluoromethyl)phenyl]-2-(1,1,1,3,3,3-hexafluoro-2-propanylidene)hydrazine |