|
CAS#: 90604-92-5 Product: 1-O-Phosphonato-D-glucitol No suppilers available for the product. |
| Name | 1-O-Phosphonato-D-glucitol |
|---|---|
| Synonyms | d-Glucitol, phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 |
| CAS Registry Number | 90604-92-5 |
| EINECS | 292-389-0 |
| SMILES | [O-]P([O-])(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/p-2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | GACTWZZMVMUKNG-JGWLITMVSA-L |
| Boiling point | 701.394°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 377.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-O-Phosphonato-D-glucitol |