|
CAS#: 91142-03-9 Product: 2-Amino-6-[(4-Methylphenyl)Amino]-1H-Pyrimidine-4-Thione No suppilers available for the product. |
| Name | 2-Amino-6-[(4-Methylphenyl)Amino]-1H-Pyrimidine-4-Thione |
|---|---|
| Synonyms | Nsc49705 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.30 |
| CAS Registry Number | 91142-03-9 |
| SMILES | C1=CC(=CC=C1NC2=CC(=S)N=C(N)N2)C |
| InChI | 1S/C11H12N4S/c1-7-2-4-8(5-3-7)13-9-6-10(16)15-11(12)14-9/h2-6H,1H3,(H4,12,13,14,15,16) |
| InChIKey | LMMCQIJFADFCAM-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.605°C at 760 mmHg (Cal.) |
| Flash point | 193.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-[(4-Methylphenyl)Amino]-1H-Pyrimidine-4-Thione |