|
CAS#: 919119-61-2 Product: 5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole No suppilers available for the product. |
| Name | 5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22BNO3 |
| Molecular Weight | 287.16 |
| CAS Registry Number | 919119-61-2 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cc(cc3c2[nH]c(c3)C)OC |
| InChI | 1S/C16H22BNO3/c1-10-7-11-8-12(19-6)9-13(14(11)18-10)17-20-15(2,3)16(4,5)21-17/h7-9,18H,1-6H3 |
| InChIKey | AAUQGODVSUVOLU-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 224.4±28.7°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |