|
CAS#: 92285-01-3 Product: 4,5,9-Trithiadodeca-1,6,11-triene 9-oxide No suppilers available for the product. |
| Name | 4,5,9-Trithiadodeca-1,6,11-triene 9-oxide |
|---|---|
| Synonyms | 3-(3-Prop-2-Enylsulfinylprop-1-Enyldisulfanyl)Prop-1-Ene; 3-[(E)-3-Allylsulfinylprop-1-Enyl]Disulfanylprop-1-Ene; 3-(3-Allylsulfinylprop-1-Enyldisulfanyl)Prop-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14OS3 |
| Molecular Weight | 234.39 |
| CAS Registry Number | 92285-01-3 |
| SMILES | C(/C=C/SSCC=C)[S](=O)CC=C |
| InChI | 1S/C9H14OS3/c1-3-6-11-12-7-5-9-13(10)8-4-2/h3-5,7H,1-2,6,8-9H2/b7-5+ |
| InChIKey | IXELFRRANAOWSF-FNORWQNLSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.047°C at 760 mmHg (Cal.) |
| Flash point | 181.227°C (Cal.) |
| (1) | Jack Li-Yang Chen, Jonathan Sperry, Nancy Y. Ip and Margaret A. Brimble. Natural products targeting telomere maintenance, Med. Chem. Commun., 2011, 2, 229. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,5,9-Trithiadodeca-1,6,11-triene 9-oxide |