|
CAS#: 93777-03-8 Product: N,N-Diethyl-2-hydroxyethanaminium [(1S)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonate No suppilers available for the product. |
| Name | N,N-Diethyl-2-hydroxyethanaminium [(1S)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonate |
|---|---|
| Synonyms | diethyl(2 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H31NO5S |
| Molecular Weight | 349.49 |
| CAS Registry Number | 93777-03-8 |
| EINECS | 298-030-4 |
| SMILES | CC2(C)C1CC(=O)[C@@]2(CC1)CS([O-])(=O)=O.CC[NH+](CC)CCO |
| InChI | 1S/C10H16O4S.C6H15NO/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-3-7(4-2)5-6-8/h7H,3-6H2,1-2H3,(H,12,13,14);8H,3-6H2,1-2H3/t7?,10-;/m1./s1 |
| InChIKey | LDKMKHPPNJOGRA-DLGLCQKISA-N |
| Boiling point | 510.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 262.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-2-hydroxyethanaminium [(1S)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonate |