|
CAS#: 94087-92-0 Product: Bis(2-oxiranylmethyl) 1,4-phenylenebiscarbamate No suppilers available for the product. |
| Name | Bis(2-oxiranylmethyl) 1,4-phenylenebiscarbamate |
|---|---|
| Synonyms | bis(oxiranylmethyl) p-phenylenebiscarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 |
| CAS Registry Number | 94087-92-0 |
| EINECS | 301-987-3 |
| SMILES | O=C(Nc2ccc(NC(=O)OCC1CO1)cc2)OCC3CO3 |
| InChI | 1S/C14H16N2O6/c17-13(21-7-11-5-19-11)15-9-1-2-10(4-3-9)16-14(18)22-8-12-6-20-12/h1-4,11-12H,5-8H2,(H,15,17)(H,16,18) |
| InChIKey | GZOVIASQAALYNB-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.001°C at 760 mmHg (Cal.) |
| Flash point | 197.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-oxiranylmethyl) 1,4-phenylenebiscarbamate |