|
CAS#: 94107-68-3 Product: P,P'-[(butylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[(butylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C6H21N3O6P2 |
| Molecular Weight | 293.20 |
| CAS Registry Number | 94107-68-3 |
| EINECS | 302-303-6 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCCC |
| InChI | 1S/C6H17NO6P2.2H3N/c1-2-3-4-7(5-14(8,9)10)6-15(11,12)13;;/h2-6H2,1H3,(H2,8,9,10)(H2,11,12,13);2*1H3/p-2 |
| InChIKey | PSGUWWUTWWVRIV-UHFFFAOYSA-L |
| Boiling point | 592.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 312.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[(butylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |