|
CAS#: 94107-70-7 Product: P,P'-[(hexylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[(hexylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C8H25N3O6P2 |
| Molecular Weight | 321.25 |
| CAS Registry Number | 94107-70-7 |
| EINECS | 302-305-7 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCCCCC |
| InChI | 1S/C8H21NO6P2.2H3N/c1-2-3-4-5-6-9(7-16(10,11)12)8-17(13,14)15;;/h2-8H2,1H3,(H2,10,11,12)(H2,13,14,15);2*1H3/p-2 |
| InChIKey | AGWOZOMWEWMBHP-UHFFFAOYSA-L |
| Boiling point | 599.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 316.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[(hexylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |