|
CAS#: 94199-85-6 Product: [(1R,2S,3R,4S)-5-(2-bromoacetyl)oxy-2,3,4-trihydroxy-1-(hydroxymethyl)pentyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(1R,2S,3R,4S)-5-(2-bromoacetyl)oxy-2,3,4-trihydroxy-1-(hydroxymethyl)pentyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol 1,5-bis(bromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16Br2O8 |
| Molecular Weight | 424.04 |
| CAS Registry Number | 94199-85-6 |
| EINECS | 303-460-3 |
| SMILES | O[C@H]([C@H](OC(=O)CBr)CO)[C@H](O)[C@@H](O)COC(=O)CBr |
| InChI | 1S/C10H16Br2O8/c11-1-7(15)19-4-5(14)9(17)10(18)6(3-13)20-8(16)2-12/h5-6,9-10,13-14,17-18H,1-4H2/t5-,6+,9+,10+/m0/s1 |
| InChIKey | IBSHJWOQTULFBH-NAXOPYRSSA-N |
| Density | 1.941g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.717°C at 760 mmHg (Cal.) |
| Flash point | 319.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2S,3R,4S)-5-(2-bromoacetyl)oxy-2,3,4-trihydroxy-1-(hydroxymethyl)pentyl] 2-bromoacetate |