|
CAS#: 952664-74-3 Product: 6-tert-butoxy-2-tert-butyl-5-nitro-1H-indole No suppilers available for the product. |
| Name | 6-tert-butoxy-2-tert-butyl-5-nitro-1H-indole |
|---|---|
| Synonyms | 6-tert-butoxy-2-tert-butyl-5-nitro-1H-indole |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 |
| CAS Registry Number | 952664-74-3 |
| SMILES | CC(C)(C)c1cc2cc(c(cc2[nH]1)OC(C)(C)C)[N+](=O)[O-] |
| InChI | 1S/C16H22N2O3/c1-15(2,3)14-8-10-7-12(18(19)20)13(9-11(10)17-14)21-16(4,5)6/h7-9,17H,1-6H3 |
| InChIKey | SVERKZLQFAYTSY-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.42°C at 760 mmHg (Cal.) |
| Flash point | 220.763°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-tert-butoxy-2-tert-butyl-5-nitro-1H-indole |