|
CAS#: 74410-87-0 Product: 4,5-Benzotricyclo[4.1.0.01,3]Hept-4-Ene No suppilers available for the product. |
| Name | 4,5-Benzotricyclo[4.1.0.01,3]Hept-4-Ene |
|---|---|
| Synonyms | 4,5-Benzotricyclo(4.1.0.01,3)Hept-4-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 |
| CAS Registry Number | 74410-87-0 |
| SMILES | C1=C2C(=CC=C1)C4C3(C2C3)C4 |
| InChI | 1S/C11H10/c1-2-4-8-7(3-1)9-5-11(9)6-10(8)11/h1-4,9-10H,5-6H2 |
| InChIKey | AMKTWDDHZREJTB-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.466°C at 760 mmHg (Cal.) |
| Flash point | 89.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Benzotricyclo[4.1.0.01,3]Hept-4-Ene |