Online Database of Chemicals from Around the World
|
CAS#: 74417-01-9 Product: 3-Methylsulfanyl-5-Naphthalen-2-Yl-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-Methylsulfanyl-5-Naphthalen-2-Yl-1,2,4-Triazine |
|---|---|
| Synonyms | 3-Methylsulfanyl-5-(2-Naphthyl)-1,2,4-Triazine; 3-(Methylthio)-5-(2-Naphthyl)-1,2,4-Triazine; 1,2,4-Triazine, 3-(Methylthio)-5-(2-Naphthalenyl)- |
| Molecular Structure |  |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.32 |
| CAS Registry Number | 74417-01-9 |
| SMILES | C1=C(N=C(N=N1)SC)C3=CC=C2C=CC=CC2=C3 |
| InChI | 1S/C14H11N3S/c1-18-14-16-13(9-15-17-14)12-7-6-10-4-2-3-5-11(10)8-12/h2-9H,1H3 |
| InChIKey | OXGALHLELGYDLD-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.538°C at 760 mmHg (Cal.) |
| Flash point | 246.84°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylsulfanyl-5-Naphthalen-2-Yl-1,2,4-Triazine |