|
CAS#: 77528-68-8 Product: N-Methyl-1-(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride No suppilers available for the product. |
| Name | N-Methyl-1-(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride |
|---|---|
| Synonyms | Methyl-[(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methyl]Amine Hydrochloride; Methyl-2 (N-Methylaminomethyl)-5 Tetrahydro-4,5,6,7-Benzo(D)Thiazole Chlorhydrate [French]; (4,5,6,7-Tetrahydro-2-Methylbenzothiazole-5-Yl)Dimethylammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.77 |
| CAS Registry Number | 77528-68-8 |
| EINECS | 278-714-9 |
| SMILES | [H+].C(NC)C2CC1=C(SC(=N1)C)CC2.[Cl-] |
| InChI | 1S/C10H16N2S.ClH/c1-7-12-9-5-8(6-11-2)3-4-10(9)13-7;/h8,11H,3-6H2,1-2H3;1H |
| InChIKey | GWYBXYYUSIJGTI-UHFFFAOYSA-N |
| Boiling point | 303.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 137.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-1-(2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride |