|
CAS#: 84604-38-6 Product: 1-(3,3,5-Trimethylcyclohexyl)Propan-1-One No suppilers available for the product. |
| Name | 1-(3,3,5-Trimethylcyclohexyl)Propan-1-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 84604-38-6 |
| EINECS | 283-317-9 |
| SMILES | C(C(=O)C1CC(CC(C1)C)(C)C)C |
| InChI | 1S/C12H22O/c1-5-11(13)10-6-9(2)7-12(3,4)8-10/h9-10H,5-8H2,1-4H3 |
| InChIKey | AQNZBQGJMZUXQX-UHFFFAOYSA-N |
| Density | 0.857g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.2°C at 760 mmHg (Cal.) |
| Flash point | 106.342°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,3,5-Trimethylcyclohexyl)Propan-1-One |