|
CAS#: 864685-12-1 Product: 6'-Ethylspiro[1,3-dioxane-2,3'-indol]-2'(1'H)-one No suppilers available for the product. |
| Name | 6'-Ethylspiro[1,3-dioxane-2,3'-indol]-2'(1'H)-one |
|---|---|
| Synonyms | SPIRO[1,3-DIOXANE-2,3'-[3H]INDOL]-2'(1'H)-ONE,6'-ETHYL- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26 |
| CAS Registry Number | 864685-12-1 |
| SMILES | CCc2cc3NC(=O)C1(OCCCO1)c3cc2 |
| InChI | 1S/C13H15NO3/c1-2-9-4-5-10-11(8-9)14-12(15)13(10)16-6-3-7-17-13/h4-5,8H,2-3,6-7H2,1H3,(H,14,15) |
| InChIKey | JFHBHPGGRWYNSP-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.655°C at 760 mmHg (Cal.) |
| Flash point | 213.648°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6'-Ethylspiro[1,3-dioxane-2,3'-indol]-2'(1'H)-one |