|
CAS#: 90604-91-4 Product: sodium 2-ethoxyethyl phosphate No suppilers available for the product. |
| Name | sodium 2-ethoxyethyl phosphate |
|---|---|
| Synonyms | Ethanol, 2-ethoxy-, phosphate, sodium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9NaO5P |
| Molecular Weight | 191.08 |
| CAS Registry Number | 90604-91-4 |
| EINECS | 292-388-5 |
| SMILES | [Na+].[O-]P(=O)([O-])OCCOCC |
| InChI | 1S/C4H11O5P.Na/c1-2-8-3-4-9-10(5,6)7;/h2-4H2,1H3,(H2,5,6,7);/q;+1/p-2 |
| InChIKey | VSHJVKIEVDVXEA-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for sodium 2-ethoxyethyl phosphate |