|
CAS#: 919119-59-8 Product: 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole No suppilers available for the product. |
| Name | 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20BNO2 |
| Molecular Weight | 257.14 |
| CAS Registry Number | 919119-59-8 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2[nH]c(c3)C |
| InChI | 1S/C15H20BNO2/c1-10-9-11-7-6-8-12(13(11)17-10)16-18-14(2,3)15(4,5)19-16/h6-9,17H,1-5H3 |
| InChIKey | JLLLSNSEZXGVMY-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.8±25.0°C at 760 mmHg (Cal.) |
| Flash point | 200.4±23.2°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |