|
CAS#: 94107-67-2 Product: P,P'-[(propylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[(propylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C5H19N3O6P2 |
| Molecular Weight | 279.17 |
| CAS Registry Number | 94107-67-2 |
| EINECS | 302-302-0 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CCC |
| InChI | 1S/C5H15NO6P2.2H3N/c1-2-3-6(4-13(7,8)9)5-14(10,11)12;;/h2-5H2,1H3,(H2,7,8,9)(H2,10,11,12);2*1H3/p-2 |
| InChIKey | IHHJYHPPYNJMPG-UHFFFAOYSA-L |
| Boiling point | 591.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 311.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[(propylimino)bis(methylene)]bis-Phosphonate ammonium salt (1:2) |