|
CAS#: 952664-72-1 Product: 2-tert-butyl-6-fluoro-5-nitro-1H-indole No suppilers available for the product. |
| Name | 2-tert-butyl-6-fluoro-5-nitro-1H-indole |
|---|---|
| Synonyms | 2-tert-butyl-6-fluoro-5-nitro-1H-indole |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.24 |
| CAS Registry Number | 952664-72-1 |
| SMILES | CC(C)(C)c1cc2cc(c(cc2[nH]1)F)[N+](=O)[O-] |
| InChI | 1S/C12H13FN2O2/c1-12(2,3)11-5-7-4-10(15(16)17)8(13)6-9(7)14-11/h4-6,14H,1-3H3 |
| InChIKey | IVMMPLNJIJIRPW-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.41°C at 760 mmHg (Cal.) |
| Flash point | 189.309°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-tert-butyl-6-fluoro-5-nitro-1H-indole |