|
CAS#: 77528-64-4 Product: Ethyl 2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazole-5-Carboxylate No suppilers available for the product. |
| Name | Ethyl 2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazole-5-Carboxylate |
|---|---|
| Synonyms | 2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazole-5-Carboxylic Acid Ethyl Ester; Ethyl 4,5,6,7-Tetrahydro-2-Methylbenzothiazole-5-Carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 |
| CAS Registry Number | 77528-64-4 |
| EINECS | 278-710-7 |
| SMILES | C(OC(=O)C2CC1=C(SC(=N1)C)CC2)C |
| InChI | 1S/C11H15NO2S/c1-3-14-11(13)8-4-5-10-9(6-8)12-7(2)15-10/h8H,3-6H2,1-2H3 |
| InChIKey | KLYDWMHKPCZUCD-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.567°C at 760 mmHg (Cal.) |
| Flash point | 151.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazole-5-Carboxylate |