|
CAS#: 94107-66-1 Product: P,P'-[[(1-methylethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[[(1-methylethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C5H19N3O6P2 |
| Molecular Weight | 279.17 |
| CAS Registry Number | 94107-66-1 |
| EINECS | 302-301-5 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])C(C)C |
| InChI | 1S/C5H15NO6P2.2H3N/c1-5(2)6(3-13(7,8)9)4-14(10,11)12;;/h5H,3-4H2,1-2H3,(H2,7,8,9)(H2,10,11,12);2*1H3/p-2 |
| InChIKey | ZXNFLOLUPCEWJB-UHFFFAOYSA-L |
| Boiling point | 583.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 306.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[[(1-methylethyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |