|
CAS#: 94107-59-2 Product: Ethyl cyclohexyl(hydroxy)2-thienylacetate No suppilers available for the product. |
| Name | Ethyl cyclohexyl(hydroxy)2-thienylacetate |
|---|---|
| Synonyms | ethyl α-cyclohexyl-α-hydroxythiophen-2-acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.37 |
| CAS Registry Number | 94107-59-2 |
| EINECS | 302-292-8 |
| SMILES | OC(C1CCCCC1)(c2cccs2)C(=O)OCC |
| InChI | 1S/C14H20O3S/c1-2-17-13(15)14(16,12-9-6-10-18-12)11-7-4-3-5-8-11/h6,9-11,16H,2-5,7-8H2,1H3 |
| InChIKey | UWKQSWZLVGSIHT-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.981°C at 760 mmHg (Cal.) |
| Flash point | 191.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl cyclohexyl(hydroxy)2-thienylacetate |