|
CAS#: 94107-41-2 Product: N-(2-Bromo-3-methylbutanoyl)-L-phenylalanine No suppilers available for the product. |
| Name | N-(2-Bromo-3-methylbutanoyl)-L-phenylalanine |
|---|---|
| Synonyms | N-(2-bromo-3-methylbutyryl)-3-phenyl-DL-alanine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.20 |
| CAS Registry Number | 94107-41-2 |
| EINECS | 302-275-5 |
| SMILES | CC(C)C(Br)C(=O)N[C@@H](Cc1ccccc1)C(O)=O |
| InChI | 1S/C14H18BrNO3/c1-9(2)12(15)13(17)16-11(14(18)19)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,16,17)(H,18,19)/t11-,12?/m0/s1 |
| InChIKey | RGIHFSFFOHEHAX-PXYINDEMSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.643°C at 760 mmHg (Cal.) |
| Flash point | 254.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Bromo-3-methylbutanoyl)-L-phenylalanine |